Clear Search sequence regions
Bookmark Forward

QuickView for 1,4-DPB (compound)


PubChem
Name: 1,4-diphenylbutadiyne
PubChem Compound ID: 70174
Molecular formula: C16H10
Molecular weight: 202.251 g/mol
Synonyms:
EINECS 212-953-1; NSC 529170; NSC529170; InChI=1/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12; 1,4-Diphenyl-1,3-butadiyne; Diphenyl-1,3-butadiyne; 1,1'-(1,3-Butadiyne-1,4-diyl)bisbenzene; Benzene, 1,1'-(1,3-butadiyne-1,4-diyl)bis-; 886-66-8; Benzene, 1,1'- (1,3-butadiyne-1,4-diyl)bis-.
show more »